3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid

C15H21NO2 — CID 125130835

IUPAC3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid
SMILESC[C@H]1[C@H](Cc2ccccc2)CCN1CCC(=O)O
InChIInChI=1S/C15H21NO2/c1-12-14(11-13-5-3-2-4-6-13)7-9-16(12)10-8-15(17)18/h2-6,12,14H,7-11H2,1H3,(H,17,18)/t12-,14-/m0/s1
InChIKeyDYCIXKSKOLWLPX-JSGCOSHPSA-N
MW247.34 g/mol
LogP2.41
Rot. Bonds5

About 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid

3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid (PubChem CID 125130835) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid.

Molecular Properties

Compound Name3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid
PubChem CID125130835
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Name3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid
SMILESC[C@H]1[C@H](Cc2ccccc2)CCN1CCC(=O)O
InChIInChI=1S/C15H21NO2/c1-12-14(11-13-5-3-2-4-6-13)7-9-16(12)10-8-15(17)18/h2-6,12,14H,7-11H2,1H3,(H,17,18)/t12-,14-/m0/s1
InChIKeyDYCIXKSKOLWLPX-JSGCOSHPSA-N
XLogP2.41
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid?
The IUPAC name of 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid (CID 125130835) is 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid.
What is the SMILES notation for 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid?
The canonical SMILES for 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid is C[C@H]1[C@H](Cc2ccccc2)CCN1CCC(=O)O.
What is the InChIKey of 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid?
The InChIKey is DYCIXKSKOLWLPX-JSGCOSHPSA-N. The full InChI is InChI=1S/C15H21NO2/c1-12-14(11-13-5-3-2-4-6-13)7-9-16(12)10-8-15(17)18/h2-6,12,14H,7-11H2,1H3,(H,17,18)/t12-,14-/m0/s1.
What are the key properties of 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid?
3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid has a molecular weight of 247.34 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,3R)-3-benzyl-2-methylpyrrolidin-1-yl]propanoic acid is sourced from PubChem (CID 125130835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).