About (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile
(3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile (PubChem CID 125131193) has the molecular formula C12H9ClF2N2O2
and a molecular weight of 286.67 g/mol. Its IUPAC name is (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile.
Molecular Properties
| Compound Name | (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile |
| PubChem CID | 125131193 |
| Molecular Formula | C12H9ClF2N2O2 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile |
| SMILES | N#C[C@H]1COCCN1C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H9ClF2N2O2/c13-9-4-11(15)10(14)3-8(9)12(18)17-1-2-19-6-7(17)5-16/h3-4,7H,1-2,6H2/t7-/m0/s1 |
| InChIKey | UUSJKHVKKGZKSW-ZETCQYMHSA-N |
| XLogP | 1.98 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile?
The IUPAC name of (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile (CID 125131193) is (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile.
What is the SMILES notation for (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile?
The canonical SMILES for (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile is N#C[C@H]1COCCN1C(=O)c1cc(F)c(F)cc1Cl.
What is the InChIKey of (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile?
The InChIKey is UUSJKHVKKGZKSW-ZETCQYMHSA-N. The full InChI is InChI=1S/C12H9ClF2N2O2/c13-9-4-11(15)10(14)3-8(9)12(18)17-1-2-19-6-7(17)5-16/h3-4,7H,1-2,6H2/t7-/m0/s1.
What are the key properties of (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile?
(3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile has a molecular weight of 286.67 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-(2-chloro-4,5-difluorobenzoyl)morpholine-3-carbonitrile is sourced from PubChem (CID 125131193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).