About 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole
5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole (PubChem CID 12513330) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole |
| PubChem CID | 12513330 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole |
| SMILES | Cc1cnc(-c2onc(C)c2C)c(C)c1 |
| InChI | InChI=1S/C12H14N2O/c1-7-5-8(2)11(13-6-7)12-9(3)10(4)14-15-12/h5-6H,1-4H3 |
| InChIKey | MZWJNYJEFVXGJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole?
The IUPAC name of 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole (CID 12513330) is 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole.
What is the SMILES notation for 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole?
The canonical SMILES for 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole is Cc1cnc(-c2onc(C)c2C)c(C)c1.
What is the InChIKey of 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole?
The InChIKey is MZWJNYJEFVXGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-7-5-8(2)11(13-6-7)12-9(3)10(4)14-15-12/h5-6H,1-4H3.
What are the key properties of 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole?
5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole has a molecular weight of 202.26 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethyl-2-pyridinyl)-3,4-dimethyl-1,2-oxazole is sourced from PubChem (CID 12513330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).