C20H15N3O2 — CID 12513435
14-phenyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione (PubChem CID 12513435) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 14-phenyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione.
| Compound Name | 14-phenyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione |
|---|---|
| PubChem CID | 12513435 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 14-phenyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1C=CC=CC3=C1C2C=CC=C3 |
| InChI | InChI=1S/C20H15N3O2/c24-19-21(15-10-2-1-3-11-15)20(25)23-17-13-7-5-9-14-8-4-6-12-16(18(14)17)22(19)23/h1-13,16-17H |
| InChIKey | PSOMPIRZRQVZRB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |