C15H20ClN3O4 — CID 125134434
4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methyl-N-[(3S)-pyrrolidin-3-yl]benzamide (PubChem CID 125134434) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methyl-N-[(3S)-pyrrolidin-3-yl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methyl-N-[(3S)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 125134434 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methyl-N-[(3S)-pyrrolidin-3-yl]benzamide |
| SMILES | COc1cc(C(=O)N(C)[C@H]2CCNC2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C15H20ClN3O4/c1-19(10-3-4-18-7-10)15(21)9-5-11(16)14(12(6-9)22-2)23-8-13(17)20/h5-6,10,18H,3-4,7-8H2,1-2H3,(H2,17,20)/t10-/m0/s1 |
| InChIKey | FBMFVQCWTQBAOT-JTQLQIEISA-N |
| XLogP | 0.65 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |