C16H21FN2O — CID 125134753
[1-(2-fluorophenyl)cyclopropyl]-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 125134753) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is [1-(2-fluorophenyl)cyclopropyl]-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)cyclopropyl]-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 125134753 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [1-(2-fluorophenyl)cyclopropyl]-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNC[C@H]1CCN(C(=O)C2(c3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C16H21FN2O/c1-18-10-12-6-9-19(11-12)15(20)16(7-8-16)13-4-2-3-5-14(13)17/h2-5,12,18H,6-11H2,1H3/t12-/m1/s1 |
| InChIKey | UVHKUNGUJMVYAN-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |