About 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine
2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine (PubChem CID 12513498) has the molecular formula C10H13N4S+
and a molecular weight of 221.31 g/mol. Its IUPAC name is 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine |
| PubChem CID | 12513498 |
| Molecular Formula | C10H13N4S+ |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1ncc(C[n+]2cscc2C)c(N)n1 |
| InChI | InChI=1S/C10H13N4S/c1-7-5-15-6-14(7)4-9-3-12-8(2)13-10(9)11/h3,5-6H,4H2,1-2H3,(H2,11,12,13)/q+1 |
| InChIKey | PDJDWXWOZQOGAS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine?
The IUPAC name of 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine (CID 12513498) is 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine.
What is the SMILES notation for 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine?
The canonical SMILES for 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine is Cc1ncc(C[n+]2cscc2C)c(N)n1.
What is the InChIKey of 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine?
The InChIKey is PDJDWXWOZQOGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N4S/c1-7-5-15-6-14(7)4-9-3-12-8(2)13-10(9)11/h3,5-6H,4H2,1-2H3,(H2,11,12,13)/q+1.
What are the key properties of 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine?
2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine has a molecular weight of 221.31 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(4-methyl-1,3-thiazol-3-ium-3-yl)methyl]pyrimidin-4-amine is sourced from PubChem (CID 12513498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).