C16H25FN4 — CID 125135597
5-fluoro-2-[(3S)-3-[[(2S)-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]pyrimidine (PubChem CID 125135597) has the molecular formula C16H25FN4 and a molecular weight of 292.40 g/mol. Its IUPAC name is 5-fluoro-2-[(3S)-3-[[(2S)-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-fluoro-2-[(3S)-3-[[(2S)-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 125135597 |
| Molecular Formula | C16H25FN4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 5-fluoro-2-[(3S)-3-[[(2S)-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]pyrimidine |
| SMILES | C[C@H]1CCCCN1C[C@@H]1CCCN(c2ncc(F)cn2)C1 |
| InChI | InChI=1S/C16H25FN4/c1-13-5-2-3-7-20(13)11-14-6-4-8-21(12-14)16-18-9-15(17)10-19-16/h9-10,13-14H,2-8,11-12H2,1H3/t13-,14-/m0/s1 |
| InChIKey | IUVKFZVETVUELB-KBPBESRZSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |