C19H28N4O2 — CID 125136009
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[(2S,4S)-2-tert-butyloxan-4-yl]urea (PubChem CID 125136009) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[(2S,4S)-2-tert-butyloxan-4-yl]urea.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[(2S,4S)-2-tert-butyloxan-4-yl]urea |
|---|---|
| PubChem CID | 125136009 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[(2S,4S)-2-tert-butyloxan-4-yl]urea |
| SMILES | CC(C)(C)[C@@H]1C[C@@H](NC(=O)NCCc2nc3ccccc3[nH]2)CCO1 |
| InChI | InChI=1S/C19H28N4O2/c1-19(2,3)16-12-13(9-11-25-16)21-18(24)20-10-8-17-22-14-6-4-5-7-15(14)23-17/h4-7,13,16H,8-12H2,1-3H3,(H,22,23)(H2,20,21,24)/t13-,16-/m0/s1 |
| InChIKey | KBDZVLFDPGBQQO-BBRMVZONSA-N |
| XLogP | 3.00 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |