C17H26N2O4 — CID 125136206
1-[(2R)-2-(4-methoxyphenoxy)propyl]-3-[(2R,4R)-2-methyloxan-4-yl]urea (PubChem CID 125136206) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(2R)-2-(4-methoxyphenoxy)propyl]-3-[(2R,4R)-2-methyloxan-4-yl]urea.
| Compound Name | 1-[(2R)-2-(4-methoxyphenoxy)propyl]-3-[(2R,4R)-2-methyloxan-4-yl]urea |
|---|---|
| PubChem CID | 125136206 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(2R)-2-(4-methoxyphenoxy)propyl]-3-[(2R,4R)-2-methyloxan-4-yl]urea |
| SMILES | COc1ccc(O[C@H](C)CNC(=O)N[C@@H]2CCO[C@H](C)C2)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-12-10-14(8-9-22-12)19-17(20)18-11-13(2)23-16-6-4-15(21-3)5-7-16/h4-7,12-14H,8-11H2,1-3H3,(H2,18,19,20)/t12-,13-,14-/m1/s1 |
| InChIKey | FBAHASYVQFPOAK-MGPQQGTHSA-N |
| XLogP | 2.33 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |