About 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane
4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (PubChem CID 12513636) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
| PubChem CID | 12513636 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
| SMILES | CC1(C)OC2C3CCC(C3)C2O1 |
| InChI | InChI=1S/C10H16O2/c1-10(2)11-8-6-3-4-7(5-6)9(8)12-10/h6-9H,3-5H2,1-2H3 |
| InChIKey | JGZIHBIYBQJDMR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
The IUPAC name of 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (CID 12513636) is 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
The canonical SMILES for 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane is CC1(C)OC2C3CCC(C3)C2O1.
What is the InChIKey of 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
The InChIKey is JGZIHBIYBQJDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-10(2)11-8-6-3-4-7(5-6)9(8)12-10/h6-9H,3-5H2,1-2H3.
What are the key properties of 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane has a molecular weight of 168.24 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 12513636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).