About 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile
6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile (PubChem CID 125137240) has the molecular formula C11H10FN3
and a molecular weight of 203.22 g/mol. Its IUPAC name is 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile |
| PubChem CID | 125137240 |
| Molecular Formula | C11H10FN3 |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC=C(F)C2)nc1 |
| InChI | InChI=1S/C11H10FN3/c12-10-2-1-5-15(8-10)11-4-3-9(6-13)7-14-11/h2-4,7H,1,5,8H2 |
| InChIKey | KLVZSXDCONPIAQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile?
The IUPAC name of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile (CID 125137240) is 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile?
The canonical SMILES for 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile is N#Cc1ccc(N2CCC=C(F)C2)nc1.
What is the InChIKey of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile?
The InChIKey is KLVZSXDCONPIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3/c12-10-2-1-5-15(8-10)11-4-3-9(6-13)7-14-11/h2-4,7H,1,5,8H2.
What are the key properties of 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile?
6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile has a molecular weight of 203.22 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 125137240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).