About 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide
2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide (PubChem CID 125137305) has the molecular formula C17H23N5O2
and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide |
| PubChem CID | 125137305 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide |
| SMILES | CC(C)[C@@H]1C[C@@H](CC(=O)Nc2ccc(-c3nn[nH]n3)cc2)CCO1 |
| InChI | InChI=1S/C17H23N5O2/c1-11(2)15-9-12(7-8-24-15)10-16(23)18-14-5-3-13(4-6-14)17-19-21-22-20-17/h3-6,11-12,15H,7-10H2,1-2H3,(H,18,23)(H,19,20,21,22)/t12-,15-/m0/s1 |
| InChIKey | GTEGTKTZBGTVDI-WFASDCNBSA-N |
| XLogP | 2.65 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide?
The IUPAC name of 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide (CID 125137305) is 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide.
What is the SMILES notation for 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide?
The canonical SMILES for 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide is CC(C)[C@@H]1C[C@@H](CC(=O)Nc2ccc(-c3nn[nH]n3)cc2)CCO1.
What is the InChIKey of 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide?
The InChIKey is GTEGTKTZBGTVDI-WFASDCNBSA-N. The full InChI is InChI=1S/C17H23N5O2/c1-11(2)15-9-12(7-8-24-15)10-16(23)18-14-5-3-13(4-6-14)17-19-21-22-20-17/h3-6,11-12,15H,7-10H2,1-2H3,(H,18,23)(H,19,20,21,22)/t12-,15-/m0/s1.
What are the key properties of 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide?
2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide has a molecular weight of 329.40 g/mol, XLogP of 2.65, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S)-2-propan-2-yloxan-4-yl]-N-[4-(2H-tetrazol-5-yl)phenyl]acetamide is sourced from PubChem (CID 125137305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).