C18H24N2O2 — CID 125139196
1-[2-[(2S,4R)-2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 125139196) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[2-[(2S,4R)-2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[(2S,4R)-2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 125139196 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[2-[(2S,4R)-2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc([C@H]2C[C@H](C)N(CCN3C(=O)CCC3=O)C2)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-13-3-5-15(6-4-13)16-11-14(2)19(12-16)9-10-20-17(21)7-8-18(20)22/h3-6,14,16H,7-12H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | FIEURRUQYJEZSK-HOCLYGCPSA-N |
| XLogP | 2.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|