About [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea
[(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea (PubChem CID 125139241) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea.
Molecular Properties
| Compound Name | [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea |
| PubChem CID | 125139241 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea |
| SMILES | C=CC[C@@H]1N(C(=O)[C@H](C)NC(N)=O)CCCC1(C)C |
| InChI | InChI=1S/C14H25N3O2/c1-5-7-11-14(3,4)8-6-9-17(11)12(18)10(2)16-13(15)19/h5,10-11H,1,6-9H2,2-4H3,(H3,15,16,19)/t10-,11-/m0/s1 |
| InChIKey | SDJAALPRFUPLHR-QWRGUYRKSA-N |
| XLogP | 1.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea?
The IUPAC name of [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea (CID 125139241) is [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea.
What is the SMILES notation for [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea?
The canonical SMILES for [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea is C=CC[C@@H]1N(C(=O)[C@H](C)NC(N)=O)CCCC1(C)C.
What is the InChIKey of [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea?
The InChIKey is SDJAALPRFUPLHR-QWRGUYRKSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-5-7-11-14(3,4)8-6-9-17(11)12(18)10(2)16-13(15)19/h5,10-11H,1,6-9H2,2-4H3,(H3,15,16,19)/t10-,11-/m0/s1.
What are the key properties of [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea?
[(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea has a molecular weight of 267.37 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidin-1-yl]-1-oxopropan-2-yl]urea is sourced from PubChem (CID 125139241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).