About [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol
[(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol (PubChem CID 125139502) has the molecular formula C15H22FNO5S
and a molecular weight of 347.41 g/mol. Its IUPAC name is [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol |
| PubChem CID | 125139502 |
| Molecular Formula | C15H22FNO5S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol |
| SMILES | COCCO[C@H]1C[C@@H](CO)CN(S(=O)(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C15H22FNO5S/c1-21-6-7-22-13-8-12(11-18)9-17(10-13)23(19,20)15-5-3-2-4-14(15)16/h2-5,12-13,18H,6-11H2,1H3/t12-,13+/m1/s1 |
| InChIKey | WHEXVADKOGFMLD-OLZOCXBDSA-N |
| XLogP | 0.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol?
The IUPAC name of [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol (CID 125139502) is [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol.
What is the SMILES notation for [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol?
The canonical SMILES for [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol is COCCO[C@H]1C[C@@H](CO)CN(S(=O)(=O)c2ccccc2F)C1.
What is the InChIKey of [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol?
The InChIKey is WHEXVADKOGFMLD-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H22FNO5S/c1-21-6-7-22-13-8-12(11-18)9-17(10-13)23(19,20)15-5-3-2-4-14(15)16/h2-5,12-13,18H,6-11H2,1H3/t12-,13+/m1/s1.
What are the key properties of [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol?
[(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol has a molecular weight of 347.41 g/mol, XLogP of 0.86, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-1-(2-fluorophenyl)sulfonyl-5-(2-methoxyethoxy)piperidin-3-yl]methanol is sourced from PubChem (CID 125139502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).