About (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one
(12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one (PubChem CID 12513955) has the molecular formula C12H20O2S2
and a molecular weight of 260.42 g/mol. Its IUPAC name is (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one.
Molecular Properties
| Compound Name | (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one |
| PubChem CID | 12513955 |
| Molecular Formula | C12H20O2S2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one |
| SMILES | C[C@@H]1CCC2(CCCCC(=O)O1)SCCS2 |
| InChI | InChI=1S/C12H20O2S2/c1-10-5-7-12(15-8-9-16-12)6-3-2-4-11(13)14-10/h10H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | QOVIYZVZVRTLEF-SNVBAGLBSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one?
The IUPAC name of (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one (CID 12513955) is (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one.
What is the SMILES notation for (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one?
The canonical SMILES for (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one is C[C@@H]1CCC2(CCCCC(=O)O1)SCCS2.
What is the InChIKey of (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one?
The InChIKey is QOVIYZVZVRTLEF-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H20O2S2/c1-10-5-7-12(15-8-9-16-12)6-3-2-4-11(13)14-10/h10H,2-9H2,1H3/t10-/m1/s1.
What are the key properties of (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one?
(12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one has a molecular weight of 260.42 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (12R)-12-methyl-11-oxa-1,4-dithiaspiro[4.9]tetradecan-10-one is sourced from PubChem (CID 12513955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).