About 2,5-dimethylthiophene
2,5-dimethylthiophene (PubChem CID 12514) has the molecular formula C6H8S
and a molecular weight of 112.20 g/mol. Its IUPAC name is 2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 2,5-dimethylthiophene |
| PubChem CID | 12514 |
| Molecular Formula | C6H8S |
| Molecular Weight | 112.20 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | 2,5-dimethylthiophene |
| SMILES | Cc1ccc(C)s1 |
| InChI | InChI=1S/C6H8S/c1-5-3-4-6(2)7-5/h3-4H,1-2H3 |
| InChIKey | GWQOOADXMVQEFT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylthiophene?
The IUPAC name of 2,5-dimethylthiophene (CID 12514) is 2,5-dimethylthiophene.
What is the SMILES notation for 2,5-dimethylthiophene?
The canonical SMILES for 2,5-dimethylthiophene is Cc1ccc(C)s1.
What is the InChIKey of 2,5-dimethylthiophene?
The InChIKey is GWQOOADXMVQEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8S/c1-5-3-4-6(2)7-5/h3-4H,1-2H3.
What are the key properties of 2,5-dimethylthiophene?
2,5-dimethylthiophene has a molecular weight of 112.20 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylthiophene is sourced from PubChem (CID 12514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).