C16H17F3N4O — CID 125140422
(3R)-3-cyano-4-methyl-N-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboxamide (PubChem CID 125140422) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is (3R)-3-cyano-4-methyl-N-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboxamide.
| Compound Name | (3R)-3-cyano-4-methyl-N-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 125140422 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3R)-3-cyano-4-methyl-N-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)N[C@@H]2C[C@H]2c2cc(F)c(F)c(F)c2)C[C@@H]1C#N |
| InChI | InChI=1S/C16H17F3N4O/c1-22-2-3-23(8-10(22)7-20)16(24)21-14-6-11(14)9-4-12(17)15(19)13(18)5-9/h4-5,10-11,14H,2-3,6,8H2,1H3,(H,21,24)/t10-,11-,14+/m0/s1 |
| InChIKey | JHFRALNYOKUEIV-COPLHBTASA-N |
| XLogP | 1.81 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|