C14H15F2NO3S — CID 125140782
[(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone (PubChem CID 125140782) has the molecular formula C14H15F2NO3S and a molecular weight of 315.34 g/mol. Its IUPAC name is [(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone.
| Compound Name | [(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 125140782 |
| Molecular Formula | C14H15F2NO3S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1c(F)ccc(O)c1F)N1CCS[C@H]2COCC[C@H]21 |
| InChI | InChI=1S/C14H15F2NO3S/c15-8-1-2-10(18)13(16)12(8)14(19)17-4-6-21-11-7-20-5-3-9(11)17/h1-2,9,11,18H,3-7H2/t9-,11+/m1/s1 |
| InChIKey | LJPVYJODOUWTKZ-KOLCDFICSA-N |
| XLogP | 2.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |