About 5-bromo-1,3-benzodioxole-4-carboxylic acid
5-bromo-1,3-benzodioxole-4-carboxylic acid (PubChem CID 12514106) has the molecular formula C8H5BrO4
and a molecular weight of 245.03 g/mol. Its IUPAC name is 5-bromo-1,3-benzodioxole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-1,3-benzodioxole-4-carboxylic acid |
| PubChem CID | 12514106 |
| Molecular Formula | C8H5BrO4 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 5-bromo-1,3-benzodioxole-4-carboxylic acid |
| SMILES | O=C(O)c1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C8H5BrO4/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2,(H,10,11) |
| InChIKey | HDNXEXSQANVCKC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1,3-benzodioxole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-benzodioxole-4-carboxylic acid?
The IUPAC name of 5-bromo-1,3-benzodioxole-4-carboxylic acid (CID 12514106) is 5-bromo-1,3-benzodioxole-4-carboxylic acid.
What is the SMILES notation for 5-bromo-1,3-benzodioxole-4-carboxylic acid?
The canonical SMILES for 5-bromo-1,3-benzodioxole-4-carboxylic acid is O=C(O)c1c(Br)ccc2c1OCO2.
What is the InChIKey of 5-bromo-1,3-benzodioxole-4-carboxylic acid?
The InChIKey is HDNXEXSQANVCKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrO4/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2,(H,10,11).
What are the key properties of 5-bromo-1,3-benzodioxole-4-carboxylic acid?
5-bromo-1,3-benzodioxole-4-carboxylic acid has a molecular weight of 245.03 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-benzodioxole-4-carboxylic acid is sourced from PubChem (CID 12514106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).