C13H18F3N3O — CID 125142476
2-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-one (PubChem CID 125142476) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 125142476 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-one |
| SMILES | CN1CCCC[C@@H]1CCn1nc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C13H18F3N3O/c1-18-8-3-2-4-10(18)7-9-19-12(20)6-5-11(17-19)13(14,15)16/h5-6,10H,2-4,7-9H2,1H3/t10-/m1/s1 |
| InChIKey | WBQGUTPJBBMBTO-SNVBAGLBSA-N |
| XLogP | 2.14 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |