C14H20FNO3 — CID 125142880
methyl (3S)-3-fluoro-1-[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]pyrrolidine-3-carboxylate (PubChem CID 125142880) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl (3S)-3-fluoro-1-[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S)-3-fluoro-1-[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 125142880 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl (3S)-3-fluoro-1-[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(F)CCN(C(=O)[C@@H]2CC=CC[C@H]2C)C1 |
| InChI | InChI=1S/C14H20FNO3/c1-10-5-3-4-6-11(10)12(17)16-8-7-14(15,9-16)13(18)19-2/h3-4,10-11H,5-9H2,1-2H3/t10-,11-,14+/m1/s1 |
| InChIKey | LESQGRALBRZQPG-GYSYKLTISA-N |
| XLogP | 1.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|