C19H25N3O2 — CID 125143000
1-[2-[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(3,6-dihydro-2H-pyran-5-ylmethyl)urea (PubChem CID 125143000) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[2-[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(3,6-dihydro-2H-pyran-5-ylmethyl)urea.
| Compound Name | 1-[2-[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(3,6-dihydro-2H-pyran-5-ylmethyl)urea |
|---|---|
| PubChem CID | 125143000 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[2-[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(3,6-dihydro-2H-pyran-5-ylmethyl)urea |
| SMILES | O=C(NCC1=CCCOC1)Nc1ccccc1N1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C19H25N3O2/c23-19(20-11-15-4-3-9-24-13-15)21-17-5-1-2-6-18(17)22-12-14-7-8-16(22)10-14/h1-2,4-6,14,16H,3,7-13H2,(H2,20,21,23)/t14-,16-/m0/s1 |
| InChIKey | JDYNPLGSUQTAGA-HOCLYGCPSA-N |
| XLogP | 3.14 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|