About [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate
[(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate (PubChem CID 125143006) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate |
| PubChem CID | 125143006 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate |
| SMILES | CNc1nc(C)cc(C(=O)O[C@@H](C)c2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C16H16N4O3/c1-9-8-12(20-16(17-3)18-9)15(21)22-10(2)14-19-11-6-4-5-7-13(11)23-14/h4-8,10H,1-3H3,(H,17,18,20)/t10-/m0/s1 |
| InChIKey | XCNILBPCZSNNQJ-JTQLQIEISA-N |
| XLogP | 2.89 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate?
The IUPAC name of [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate (CID 125143006) is [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate.
What is the SMILES notation for [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate?
The canonical SMILES for [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate is CNc1nc(C)cc(C(=O)O[C@@H](C)c2nc3ccccc3o2)n1.
What is the InChIKey of [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate?
The InChIKey is XCNILBPCZSNNQJ-JTQLQIEISA-N. The full InChI is InChI=1S/C16H16N4O3/c1-9-8-12(20-16(17-3)18-9)15(21)22-10(2)14-19-11-6-4-5-7-13(11)23-14/h4-8,10H,1-3H3,(H,17,18,20)/t10-/m0/s1.
What are the key properties of [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate?
[(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate has a molecular weight of 312.33 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(1,3-benzoxazol-2-yl)ethyl] 6-methyl-2-(methylamino)pyrimidine-4-carboxylate is sourced from PubChem (CID 125143006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).