C19H21ClN2O3 — CID 125143999
(2S,3aR,7aS)-1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 125143999) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aS)-1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 125143999 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (2S,3aR,7aS)-1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]2CCCC[C@@H]2N1Cc1coc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H21ClN2O3/c20-14-6-3-5-13(8-14)18-21-15(11-25-18)10-22-16-7-2-1-4-12(16)9-17(22)19(23)24/h3,5-6,8,11-12,16-17H,1-2,4,7,9-10H2,(H,23,24)/t12-,16+,17+/m1/s1 |
| InChIKey | ILRKFXWPINEABT-DQYPLSBCSA-N |
| XLogP | 4.21 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |