About ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate
ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate (PubChem CID 125144131) has the molecular formula C19H22FNO4
and a molecular weight of 347.39 g/mol. Its IUPAC name is ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate |
| PubChem CID | 125144131 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate |
| SMILES | CCOC(=O)[C@@H](F)C1CN(C(=O)c2oc3c(C)ccc(C)c3c2C)C1 |
| InChI | InChI=1S/C19H22FNO4/c1-5-24-19(23)15(20)13-8-21(9-13)18(22)17-12(4)14-10(2)6-7-11(3)16(14)25-17/h6-7,13,15H,5,8-9H2,1-4H3/t15-/m0/s1 |
| InChIKey | UUZIUZMYTKHCPW-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate?
The IUPAC name of ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate (CID 125144131) is ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate.
What is the SMILES notation for ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate?
The canonical SMILES for ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate is CCOC(=O)[C@@H](F)C1CN(C(=O)c2oc3c(C)ccc(C)c3c2C)C1.
What is the InChIKey of ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate?
The InChIKey is UUZIUZMYTKHCPW-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H22FNO4/c1-5-24-19(23)15(20)13-8-21(9-13)18(22)17-12(4)14-10(2)6-7-11(3)16(14)25-17/h6-7,13,15H,5,8-9H2,1-4H3/t15-/m0/s1.
What are the key properties of ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate?
ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate has a molecular weight of 347.39 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-fluoro-2-[1-(3,4,7-trimethyl-1-benzofuran-2-carbonyl)azetidin-3-yl]acetate is sourced from PubChem (CID 125144131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).