About 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide
5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide (PubChem CID 125144254) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide.
Molecular Properties
| Compound Name | 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide |
| PubChem CID | 125144254 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide |
| SMILES | CCc1ccc2occ(C(=O)N[C@@H]3C[C@H](C)OC3=O)c2c1 |
| InChI | InChI=1S/C16H17NO4/c1-3-10-4-5-14-11(7-10)12(8-20-14)15(18)17-13-6-9(2)21-16(13)19/h4-5,7-9,13H,3,6H2,1-2H3,(H,17,18)/t9-,13+/m0/s1 |
| InChIKey | QLCMKZLKGDJXAF-TVQRCGJNSA-N |
| XLogP | 2.43 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide?
The IUPAC name of 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide (CID 125144254) is 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide.
What is the SMILES notation for 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide?
The canonical SMILES for 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide is CCc1ccc2occ(C(=O)N[C@@H]3C[C@H](C)OC3=O)c2c1.
What is the InChIKey of 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide?
The InChIKey is QLCMKZLKGDJXAF-TVQRCGJNSA-N. The full InChI is InChI=1S/C16H17NO4/c1-3-10-4-5-14-11(7-10)12(8-20-14)15(18)17-13-6-9(2)21-16(13)19/h4-5,7-9,13H,3,6H2,1-2H3,(H,17,18)/t9-,13+/m0/s1.
What are the key properties of 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide?
5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide has a molecular weight of 287.32 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N-[(3R,5S)-5-methyl-2-oxooxolan-3-yl]-1-benzofuran-3-carboxamide is sourced from PubChem (CID 125144254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).