C17H30N4O — CID 125146165
[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-(1-tert-butyl-5-ethylpyrazol-4-yl)methanone (PubChem CID 125146165) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is [(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-(1-tert-butyl-5-ethylpyrazol-4-yl)methanone.
| Compound Name | [(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-(1-tert-butyl-5-ethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 125146165 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | [(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-(1-tert-butyl-5-ethylpyrazol-4-yl)methanone |
| SMILES | CCc1c(C(=O)N2CCC[C@@H]([C@@H](C)N)C2)cnn1C(C)(C)C |
| InChI | InChI=1S/C17H30N4O/c1-6-15-14(10-19-21(15)17(3,4)5)16(22)20-9-7-8-13(11-20)12(2)18/h10,12-13H,6-9,11,18H2,1-5H3/t12-,13-/m1/s1 |
| InChIKey | FHTLDAYPUHKIGZ-CHWSQXEVSA-N |
| XLogP | 2.40 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |