1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid

C7H11NO2 — CID 12514709

IUPAC1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid
SMILESCN1CC=C(C(=O)O)CC1
InChIInChI=1S/C7H11NO2/c1-8-4-2-6(3-5-8)7(9)10/h2H,3-5H2,1H3,(H,9,10)
InChIKeyPMRLAQZPVKUNNW-UHFFFAOYSA-N
MW141.17 g/mol
LogP0.33
Rot. Bonds1

About 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid

1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid (PubChem CID 12514709) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid.

Molecular Properties

Compound Name1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid
PubChem CID12514709
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Name1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid
SMILESCN1CC=C(C(=O)O)CC1
InChIInChI=1S/C7H11NO2/c1-8-4-2-6(3-5-8)7(9)10/h2H,3-5H2,1H3,(H,9,10)
InChIKeyPMRLAQZPVKUNNW-UHFFFAOYSA-N
XLogP0.33
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
The IUPAC name of 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid (CID 12514709) is 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid.
What is the SMILES notation for 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
The canonical SMILES for 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid is CN1CC=C(C(=O)O)CC1.
What is the InChIKey of 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
The InChIKey is PMRLAQZPVKUNNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-8-4-2-6(3-5-8)7(9)10/h2H,3-5H2,1H3,(H,9,10).
What are the key properties of 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid has a molecular weight of 141.17 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,6-dihydro-2H-pyridine-4-carboxylic acid is sourced from PubChem (CID 12514709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).