About 2-piperidin-3-ylacetic acid;hydrochloride
2-piperidin-3-ylacetic acid;hydrochloride (PubChem CID 12514713) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is 2-piperidin-3-ylacetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-3-ylacetic acid;hydrochloride |
| PubChem CID | 12514713 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-piperidin-3-ylacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CC1CCCNC1 |
| InChI | InChI=1S/C7H13NO2.ClH/c9-7(10)4-6-2-1-3-8-5-6;/h6,8H,1-5H2,(H,9,10);1H |
| InChIKey | IMUCGEDHTPKPBM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-3-ylacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-3-ylacetic acid;hydrochloride?
The IUPAC name of 2-piperidin-3-ylacetic acid;hydrochloride (CID 12514713) is 2-piperidin-3-ylacetic acid;hydrochloride.
What is the SMILES notation for 2-piperidin-3-ylacetic acid;hydrochloride?
The canonical SMILES for 2-piperidin-3-ylacetic acid;hydrochloride is Cl.O=C(O)CC1CCCNC1.
What is the InChIKey of 2-piperidin-3-ylacetic acid;hydrochloride?
The InChIKey is IMUCGEDHTPKPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.ClH/c9-7(10)4-6-2-1-3-8-5-6;/h6,8H,1-5H2,(H,9,10);1H.
What are the key properties of 2-piperidin-3-ylacetic acid;hydrochloride?
2-piperidin-3-ylacetic acid;hydrochloride has a molecular weight of 179.65 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-ylacetic acid;hydrochloride is sourced from PubChem (CID 12514713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).