C16H27N3O3S — CID 125147251
(2R)-N-[(2S)-2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-methylmorpholine-4-sulfonamide (PubChem CID 125147251) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is (2R)-N-[(2S)-2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-methylmorpholine-4-sulfonamide.
| Compound Name | (2R)-N-[(2S)-2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-methylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 125147251 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2R)-N-[(2S)-2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-methylmorpholine-4-sulfonamide |
| SMILES | CC(C)c1ccc([C@H](N)CNS(=O)(=O)N2CCO[C@H](C)C2)cc1 |
| InChI | InChI=1S/C16H27N3O3S/c1-12(2)14-4-6-15(7-5-14)16(17)10-18-23(20,21)19-8-9-22-13(3)11-19/h4-7,12-13,16,18H,8-11,17H2,1-3H3/t13-,16-/m1/s1 |
| InChIKey | WJXPQDLWNNYCTL-CZUORRHYSA-N |
| XLogP | 1.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |