C17H20N2O2S2 — CID 125148477
(2S,3aS,7aS)-1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 125148477) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 125148477 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2S,3aS,7aS)-1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C17H20N2O2S2/c20-17(21)15-7-11-3-1-2-4-14(11)19(15)8-13-10-23-16(18-13)12-5-6-22-9-12/h5-6,9-11,14-15H,1-4,7-8H2,(H,20,21)/t11-,14-,15-/m0/s1 |
| InChIKey | KLZJDTDTUOAAAF-CQDKDKBSSA-N |
| XLogP | 4.09 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |