C17H14N2OS — CID 12514894
N-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 12514894) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide.
| Compound Name | N-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 12514894 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | Cn1c(-c2ccccc2)cs/c1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14N2OS/c1-19-15(13-8-4-2-5-9-13)12-21-17(19)18-16(20)14-10-6-3-7-11-14/h2-12H,1H3/b18-17- |
| InChIKey | AQJUSHUSGGALIB-ZCXUNETKSA-N |
| XLogP | 3.49 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|