C17H19NO5 — CID 125150468
2-[(2R)-4-[3-(1-benzofuran-2-yl)propanoyl]morpholin-2-yl]acetic acid (PubChem CID 125150468) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[(2R)-4-[3-(1-benzofuran-2-yl)propanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-4-[3-(1-benzofuran-2-yl)propanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 125150468 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[(2R)-4-[3-(1-benzofuran-2-yl)propanoyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CN(C(=O)CCc2cc3ccccc3o2)CCO1 |
| InChI | InChI=1S/C17H19NO5/c19-16(18-7-8-22-14(11-18)10-17(20)21)6-5-13-9-12-3-1-2-4-15(12)23-13/h1-4,9,14H,5-8,10-11H2,(H,20,21)/t14-/m1/s1 |
| InChIKey | DMFLTOAFUVLGSY-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |