About 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide
4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide (PubChem CID 1251510) has the molecular formula C19H23N3O3S
and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide |
| PubChem CID | 1251510 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide |
| SMILES | Cn1c(=O)n(C)c2cc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C19H23N3O3S/c1-19(2,3)13-6-9-15(10-7-13)26(24,25)20-14-8-11-16-17(12-14)22(5)18(23)21(16)4/h6-12,20H,1-5H3 |
| InChIKey | RYTIJJCFPOUMGP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
The IUPAC name of 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide (CID 1251510) is 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
The canonical SMILES for 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide is Cn1c(=O)n(C)c2cc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ccc21.
What is the InChIKey of 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
The InChIKey is RYTIJJCFPOUMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3S/c1-19(2,3)13-6-9-15(10-7-13)26(24,25)20-14-8-11-16-17(12-14)22(5)18(23)21(16)4/h6-12,20H,1-5H3.
What are the key properties of 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide has a molecular weight of 373.48 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 1251510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).