About (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine
(E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine (PubChem CID 12515128) has the molecular formula C12H20NO4P
and a molecular weight of 273.27 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine |
| PubChem CID | 12515128 |
| Molecular Formula | C12H20NO4P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine |
| SMILES | CCOP(=O)(OCC)/C(=C/c1ccco1)N(C)C |
| InChI | InChI=1S/C12H20NO4P/c1-5-16-18(14,17-6-2)12(13(3)4)10-11-8-7-9-15-11/h7-10H,5-6H2,1-4H3/b12-10+ |
| InChIKey | MRXCFRMWYXLVMV-ZRDIBKRKSA-N |
| XLogP | 3.41 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine?
The IUPAC name of (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine (CID 12515128) is (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine.
What is the SMILES notation for (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine?
The canonical SMILES for (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine is CCOP(=O)(OCC)/C(=C/c1ccco1)N(C)C.
What is the InChIKey of (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine?
The InChIKey is MRXCFRMWYXLVMV-ZRDIBKRKSA-N. The full InChI is InChI=1S/C12H20NO4P/c1-5-16-18(14,17-6-2)12(13(3)4)10-11-8-7-9-15-11/h7-10H,5-6H2,1-4H3/b12-10+.
What are the key properties of (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine?
(E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine has a molecular weight of 273.27 g/mol, XLogP of 3.41, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-diethoxyphosphoryl-2-(furan-2-yl)-N,N-dimethylethenamine is sourced from PubChem (CID 12515128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).