C19H24N2O4 — CID 125151891
2-[(2S)-4-[1-(2-methylpropyl)indole-3-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 125151891) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[(2S)-4-[1-(2-methylpropyl)indole-3-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-4-[1-(2-methylpropyl)indole-3-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 125151891 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[(2S)-4-[1-(2-methylpropyl)indole-3-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | CC(C)Cn1cc(C(=O)N2CCO[C@@H](CC(=O)O)C2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O4/c1-13(2)10-21-12-16(15-5-3-4-6-17(15)21)19(24)20-7-8-25-14(11-20)9-18(22)23/h3-6,12-14H,7-11H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | LXAPJTRLMMEJKA-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |