C12H19NO6 — CID 125152966
(3S)-4-[2-[[(2S)-oxolan-2-yl]methoxy]acetyl]morpholine-3-carboxylic acid (PubChem CID 125152966) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is (3S)-4-[2-[[(2S)-oxolan-2-yl]methoxy]acetyl]morpholine-3-carboxylic acid.
| Compound Name | (3S)-4-[2-[[(2S)-oxolan-2-yl]methoxy]acetyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 125152966 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (3S)-4-[2-[[(2S)-oxolan-2-yl]methoxy]acetyl]morpholine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1COCCN1C(=O)COC[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H19NO6/c14-11(8-18-6-9-2-1-4-19-9)13-3-5-17-7-10(13)12(15)16/h9-10H,1-8H2,(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | RLMPMRQXMOROMN-UWVGGRQHSA-N |
| XLogP | -0.51 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |