C16H20FNO4 — CID 125153431
(3S)-4-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]morpholine-3-carboxylic acid (PubChem CID 125153431) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is (3S)-4-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]morpholine-3-carboxylic acid.
| Compound Name | (3S)-4-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 125153431 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (3S)-4-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]morpholine-3-carboxylic acid |
| SMILES | C[C@@H](CCc1cccc(F)c1)C(=O)N1CCOC[C@H]1C(=O)O |
| InChI | InChI=1S/C16H20FNO4/c1-11(5-6-12-3-2-4-13(17)9-12)15(19)18-7-8-22-10-14(18)16(20)21/h2-4,9,11,14H,5-8,10H2,1H3,(H,20,21)/t11-,14-/m0/s1 |
| InChIKey | UOEDHWXPNYNUNO-FZMZJTMJSA-N |
| XLogP | 1.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |