C17H25N3OS2 — CID 125155244
(7R)-3-butyl-7-(2-methylsulfanylethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 125155244) has the molecular formula C17H25N3OS2 and a molecular weight of 351.54 g/mol. Its IUPAC name is (7R)-3-butyl-7-(2-methylsulfanylethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-3-butyl-7-(2-methylsulfanylethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 125155244 |
| Molecular Formula | C17H25N3OS2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (7R)-3-butyl-7-(2-methylsulfanylethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCn1cnc2sc3c(c2c1=O)CC[C@@H](NCCSC)C3 |
| InChI | InChI=1S/C17H25N3OS2/c1-3-4-8-20-11-19-16-15(17(20)21)13-6-5-12(10-14(13)23-16)18-7-9-22-2/h11-12,18H,3-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | FLLHWUIIYKWXDZ-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|