C11H11ClN2 — CID 12515598
4-chloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole (PubChem CID 12515598) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 4-chloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole.
| Compound Name | 4-chloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 12515598 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4-chloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole |
| SMILES | ClC1CCCn2c1nc1ccccc12 |
| InChI | InChI=1S/C11H11ClN2/c12-8-4-3-7-14-10-6-2-1-5-9(10)13-11(8)14/h1-2,5-6,8H,3-4,7H2 |
| InChIKey | KLJFVZQJYHXXLV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|