C17H23N3O2 — CID 125160120
N-[[(3S)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-3-methylpyridine-4-carboxamide (PubChem CID 125160120) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[[(3S)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-3-methylpyridine-4-carboxamide.
| Compound Name | N-[[(3S)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-3-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 125160120 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[[(3S)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-3-methylpyridine-4-carboxamide |
| SMILES | Cc1cnccc1C(=O)NC[C@@H]1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C17H23N3O2/c1-12-9-18-7-6-15(12)17(22)19-10-13-8-16(21)20(11-13)14-4-2-3-5-14/h6-7,9,13-14H,2-5,8,10-11H2,1H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | XUBZGKSAFSAZPU-ZDUSSCGKSA-N |
| XLogP | 1.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |