C15H24N4O3S — CID 125160933
2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-1-(2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)ethanone (PubChem CID 125160933) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-1-(2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)ethanone.
| Compound Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-1-(2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)ethanone |
|---|---|
| PubChem CID | 125160933 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-1-(2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)ethanone |
| SMILES | Cc1cc2n(n1)CCCN(C(=O)CN(C)[C@H]1CCS(=O)(=O)C1)C2 |
| InChI | InChI=1S/C15H24N4O3S/c1-12-8-14-9-18(5-3-6-19(14)16-12)15(20)10-17(2)13-4-7-23(21,22)11-13/h8,13H,3-7,9-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | OLIBPTRJIHBZMQ-ZDUSSCGKSA-N |
| XLogP | 0.04 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |