C19H24N4O3 — CID 125161102
N-(2-methoxyethyl)-4-[[(1R)-1-pyridin-3-ylpropyl]carbamoylamino]benzamide (PubChem CID 125161102) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[(1R)-1-pyridin-3-ylpropyl]carbamoylamino]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[[(1R)-1-pyridin-3-ylpropyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 125161102 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[(1R)-1-pyridin-3-ylpropyl]carbamoylamino]benzamide |
| SMILES | CC[C@@H](NC(=O)Nc1ccc(C(=O)NCCOC)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-17(15-5-4-10-20-13-15)23-19(25)22-16-8-6-14(7-9-16)18(24)21-11-12-26-2/h4-10,13,17H,3,11-12H2,1-2H3,(H,21,24)(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | LCHJSFCXIHYJTC-QGZVFWFLSA-N |
| XLogP | 2.73 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|