C20H23FN4O — CID 125161166
N-(6-fluoro-3-pyridinyl)-4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazine-1-carboxamide (PubChem CID 125161166) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazine-1-carboxamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 125161166 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1)N1CCN([C@H]2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C20H23FN4O/c21-19-8-6-17(14-22-19)23-20(26)25-11-9-24(10-12-25)18-7-5-15-3-1-2-4-16(15)13-18/h1-4,6,8,14,18H,5,7,9-13H2,(H,23,26)/t18-/m0/s1 |
| InChIKey | GPIXURPEOMVGAE-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|