C18H20N6O3 — CID 125161407
N-[(S)-cyclopropyl-(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide (PubChem CID 125161407) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[(S)-cyclopropyl-(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide.
| Compound Name | N-[(S)-cyclopropyl-(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 125161407 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[(S)-cyclopropyl-(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide |
| SMILES | CCn1ncnc1[C@@H](NC(=O)c1ccc(N2CC(=O)NC2=O)cc1)C1CC1 |
| InChI | InChI=1S/C18H20N6O3/c1-2-24-16(19-10-20-24)15(11-3-4-11)22-17(26)12-5-7-13(8-6-12)23-9-14(25)21-18(23)27/h5-8,10-11,15H,2-4,9H2,1H3,(H,22,26)(H,21,25,27)/t15-/m0/s1 |
| InChIKey | FYTUHSHLEPLDCA-HNNXBMFYSA-N |
| XLogP | 1.24 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|