C10Cl3F7 — CID 12516163
1,1,3-trichloro-4,5,6,7-tetrafluoro-2-(trifluoromethyl)indene (PubChem CID 12516163) has the molecular formula C10Cl3F7 and a molecular weight of 359.46 g/mol. Its IUPAC name is 1,1,3-trichloro-4,5,6,7-tetrafluoro-2-(trifluoromethyl)indene.
| Compound Name | 1,1,3-trichloro-4,5,6,7-tetrafluoro-2-(trifluoromethyl)indene |
|---|---|
| PubChem CID | 12516163 |
| Molecular Formula | C10Cl3F7 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 357.90 |
| IUPAC Name | 1,1,3-trichloro-4,5,6,7-tetrafluoro-2-(trifluoromethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(Cl)=C(C(F)(F)F)C2(Cl)Cl |
| InChI | InChI=1S/C10Cl3F7/c11-3-1-2(5(15)7(17)6(16)4(1)14)9(12,13)8(3)10(18,19)20 |
| InChIKey | OVGZMQMEAJDZTO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|