C10ClF9 — CID 12516164
3-chloro-1,1,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene (PubChem CID 12516164) has the molecular formula C10ClF9 and a molecular weight of 326.55 g/mol. Its IUPAC name is 3-chloro-1,1,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene.
| Compound Name | 3-chloro-1,1,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene |
|---|---|
| PubChem CID | 12516164 |
| Molecular Formula | C10ClF9 |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 3-chloro-1,1,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(Cl)=C(C(F)(F)F)C2(F)F |
| InChI | InChI=1S/C10ClF9/c11-3-1-2(5(13)7(15)6(14)4(1)12)9(16,17)8(3)10(18,19)20 |
| InChIKey | XIKLHPUUDUMLIH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|