C6H6ClF8O3P — CID 12516178
3-[chloro(2,2,3,3-tetrafluoropropoxy)phosphoryl]oxy-1,1,2,2-tetrafluoropropane (PubChem CID 12516178) has the molecular formula C6H6ClF8O3P and a molecular weight of 344.52 g/mol. Its IUPAC name is 3-[chloro(2,2,3,3-tetrafluoropropoxy)phosphoryl]oxy-1,1,2,2-tetrafluoropropane.
| Compound Name | 3-[chloro(2,2,3,3-tetrafluoropropoxy)phosphoryl]oxy-1,1,2,2-tetrafluoropropane |
|---|---|
| PubChem CID | 12516178 |
| Molecular Formula | C6H6ClF8O3P |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 3-[chloro(2,2,3,3-tetrafluoropropoxy)phosphoryl]oxy-1,1,2,2-tetrafluoropropane |
| SMILES | O=P(Cl)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H6ClF8O3P/c7-19(16,17-1-5(12,13)3(8)9)18-2-6(14,15)4(10)11/h3-4H,1-2H2 |
| InChIKey | FRVSZESKAFNYOV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|